About 6H-indolo[2,3-a]quinolizine-4-thione
6H-indolo[2,3-a]quinolizine-4-thione (PubChem CID 139908913) has the molecular formula C15H10N2S
and a molecular weight of 250.33 g/mol. Its IUPAC name is 6H-indolo[2,3-a]quinolizine-4-thione.
Molecular Properties
| Compound Name | 6H-indolo[2,3-a]quinolizine-4-thione |
| PubChem CID | 139908913 |
| Molecular Formula | C15H10N2S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 6H-indolo[2,3-a]quinolizine-4-thione |
| SMILES | S=c1cccc2n1CC=C1C2=Nc2ccccc21 |
| InChI | InChI=1S/C15H10N2S/c18-14-7-3-6-13-15-11(8-9-17(13)14)10-4-1-2-5-12(10)16-15/h1-8H,9H2 |
| InChIKey | YMVCMZVAYAFPIB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6H-indolo[2,3-a]quinolizine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-indolo[2,3-a]quinolizine-4-thione?
The IUPAC name of 6H-indolo[2,3-a]quinolizine-4-thione (CID 139908913) is 6H-indolo[2,3-a]quinolizine-4-thione.
What is the SMILES notation for 6H-indolo[2,3-a]quinolizine-4-thione?
The canonical SMILES for 6H-indolo[2,3-a]quinolizine-4-thione is S=c1cccc2n1CC=C1C2=Nc2ccccc21.
What is the InChIKey of 6H-indolo[2,3-a]quinolizine-4-thione?
The InChIKey is YMVCMZVAYAFPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2S/c18-14-7-3-6-13-15-11(8-9-17(13)14)10-4-1-2-5-12(10)16-15/h1-8H,9H2.
What are the key properties of 6H-indolo[2,3-a]quinolizine-4-thione?
6H-indolo[2,3-a]quinolizine-4-thione has a molecular weight of 250.33 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-indolo[2,3-a]quinolizine-4-thione is sourced from PubChem (CID 139908913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).