C13H11NS — CID 90992606
6,7-dihydrobenzo[a]quinolizine-4-thione (PubChem CID 90992606) has the molecular formula C13H11NS and a molecular weight of 213.31 g/mol. Its IUPAC name is 6,7-dihydrobenzo[a]quinolizine-4-thione.
| Compound Name | 6,7-dihydrobenzo[a]quinolizine-4-thione |
|---|---|
| PubChem CID | 90992606 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 6,7-dihydrobenzo[a]quinolizine-4-thione |
| SMILES | S=c1cccc2n1CCc1ccccc1-2 |
| InChI | InChI=1S/C13H11NS/c15-13-7-3-6-12-11-5-2-1-4-10(11)8-9-14(12)13/h1-7H,8-9H2 |
| InChIKey | DVVZYXDMWNNGPS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|