C29H41N3O3S — CID 139909444
3-phenylpropyl 4-(cyclohexen-1-yl)-2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 139909444) has the molecular formula C29H41N3O3S and a molecular weight of 511.73 g/mol. Its IUPAC name is 3-phenylpropyl 4-(cyclohexen-1-yl)-2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | 3-phenylpropyl 4-(cyclohexen-1-yl)-2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 139909444 |
| Molecular Formula | C29H41N3O3S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 3-phenylpropyl 4-(cyclohexen-1-yl)-2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CSC1=NC(C2=CCCCC2)C(C(=O)OCCCc2ccccc2)=C(COCCN2CCCCC2)N1 |
| InChI | InChI=1S/C29H41N3O3S/c1-36-29-30-25(22-34-21-19-32-17-9-4-10-18-32)26(27(31-29)24-15-7-3-8-16-24)28(33)35-20-11-14-23-12-5-2-6-13-23/h2,5-6,12-13,15,27H,3-4,7-11,14,16-22H2,1H3,(H,30,31) |
| InChIKey | WWPCHBSADLIHRG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|