C32H38N4O3S — CID 18789238
3-phenylpropyl 2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-4-quinolin-2-yl-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 18789238) has the molecular formula C32H38N4O3S and a molecular weight of 558.75 g/mol. Its IUPAC name is 3-phenylpropyl 2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-4-quinolin-2-yl-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | 3-phenylpropyl 2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-4-quinolin-2-yl-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 18789238 |
| Molecular Formula | C32H38N4O3S |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 3-phenylpropyl 2-methylsulfanyl-6-(2-piperidin-1-ylethoxymethyl)-4-quinolin-2-yl-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CSC1=NC(c2ccc3ccccc3n2)C(C(=O)OCCCc2ccccc2)=C(COCCN2CCCCC2)N1 |
| InChI | InChI=1S/C32H38N4O3S/c1-40-32-34-28(23-38-22-20-36-18-8-3-9-19-36)29(31(37)39-21-10-13-24-11-4-2-5-12-24)30(35-32)27-17-16-25-14-6-7-15-26(25)33-27/h2,4-7,11-12,14-17,30H,3,8-10,13,18-23H2,1H3,(H,34,35) |
| InChIKey | SNARSHIJAKKXPK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|