C33H36N4O4 — CID 22005510
3-phenylpropyl 4-(4-cyanophenyl)-2-(furan-2-yl)-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 22005510) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-phenylpropyl 4-(4-cyanophenyl)-2-(furan-2-yl)-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | 3-phenylpropyl 4-(4-cyanophenyl)-2-(furan-2-yl)-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22005510 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3-phenylpropyl 4-(4-cyanophenyl)-2-(furan-2-yl)-6-(2-piperidin-1-ylethoxymethyl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | N#Cc1ccc(C2N=C(c3ccco3)NC(COCCN3CCCCC3)=C2C(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H36N4O4/c34-23-26-13-15-27(16-14-26)31-30(33(38)41-21-7-11-25-9-3-1-4-10-25)28(35-32(36-31)29-12-8-20-40-29)24-39-22-19-37-17-5-2-6-18-37/h1,3-4,8-10,12-16,20,31H,2,5-7,11,17-19,21-22,24H2,(H,35,36) |
| InChIKey | ISEMPKAUWZTCCQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|