C11H13NS — CID 139910118
10-thia-2-azatricyclo[7.4.0.03,7]trideca-4,6,8-triene (PubChem CID 139910118) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 10-thia-2-azatricyclo[7.4.0.03,7]trideca-4,6,8-triene.
| Compound Name | 10-thia-2-azatricyclo[7.4.0.03,7]trideca-4,6,8-triene |
|---|---|
| PubChem CID | 139910118 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 10-thia-2-azatricyclo[7.4.0.03,7]trideca-4,6,8-triene |
| SMILES | C1=CC2NC3CCCSC3=CC2=C1 |
| InChI | InChI=1S/C11H13NS/c1-3-8-7-11-10(5-2-6-13-11)12-9(8)4-1/h1,3-4,7,9-10,12H,2,5-6H2 |
| InChIKey | KDAGWUTUTNTWFM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |