C22H18F3N3O4 — CID 139912644
[[7-[(E)-hydrazinylidenemethyl]naphthalen-1-yl]-(2-phenylmethoxyacetyl)amino] 2,2,2-trifluoroacetate (PubChem CID 139912644) has the molecular formula C22H18F3N3O4 and a molecular weight of 445.40 g/mol. Its IUPAC name is [[7-[(E)-hydrazinylidenemethyl]naphthalen-1-yl]-(2-phenylmethoxyacetyl)amino] 2,2,2-trifluoroacetate.
| Compound Name | [[7-[(E)-hydrazinylidenemethyl]naphthalen-1-yl]-(2-phenylmethoxyacetyl)amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139912644 |
| Molecular Formula | C22H18F3N3O4 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [[7-[(E)-hydrazinylidenemethyl]naphthalen-1-yl]-(2-phenylmethoxyacetyl)amino] 2,2,2-trifluoroacetate |
| SMILES | N/N=C/c1ccc2cccc(N(OC(=O)C(F)(F)F)C(=O)COCc3ccccc3)c2c1 |
| InChI | InChI=1S/C22H18F3N3O4/c23-22(24,25)21(30)32-28(20(29)14-31-13-15-5-2-1-3-6-15)19-8-4-7-17-10-9-16(12-27-26)11-18(17)19/h1-12H,13-14,26H2/b27-12+ |
| InChIKey | RORMZPUWQUELEG-KKMKTNMSSA-N |
| XLogP | 3.70 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|