C33H30ClN3O2 — CID 139914686
2-[4-[(2-chloro-9-oxoacridin-10-yl)methyl]phenyl]-2-cyclopentyl-N'-phenylacetohydrazide (PubChem CID 139914686) has the molecular formula C33H30ClN3O2 and a molecular weight of 536.08 g/mol. Its IUPAC name is 2-[4-[(2-chloro-9-oxoacridin-10-yl)methyl]phenyl]-2-cyclopentyl-N'-phenylacetohydrazide.
| Compound Name | 2-[4-[(2-chloro-9-oxoacridin-10-yl)methyl]phenyl]-2-cyclopentyl-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 139914686 |
| Molecular Formula | C33H30ClN3O2 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-[4-[(2-chloro-9-oxoacridin-10-yl)methyl]phenyl]-2-cyclopentyl-N'-phenylacetohydrazide |
| SMILES | O=C(NNc1ccccc1)C(c1ccc(Cn2c3ccccc3c(=O)c3cc(Cl)ccc32)cc1)C1CCCC1 |
| InChI | InChI=1S/C33H30ClN3O2/c34-25-18-19-30-28(20-25)32(38)27-12-6-7-13-29(27)37(30)21-22-14-16-24(17-15-22)31(23-8-4-5-9-23)33(39)36-35-26-10-2-1-3-11-26/h1-3,6-7,10-20,23,31,35H,4-5,8-9,21H2,(H,36,39) |
| InChIKey | HUSFHZIFXNBSMS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|