C11H9NO4 — CID 139917308
1-(2,3-dioxo-1-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione (PubChem CID 139917308) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 1-(2,3-dioxo-1-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,3-dioxo-1-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139917308 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-(2,3-dioxo-1-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione |
| SMILES | O=C1C(=O)C2(N3C(=O)C=CC3=O)CCC1C2 |
| InChI | InChI=1S/C11H9NO4/c13-7-1-2-8(14)12(7)11-4-3-6(5-11)9(15)10(11)16/h1-2,6H,3-5H2 |
| InChIKey | KJOSIXOPNWJYMD-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|