C10H10Br2O2 — CID 139917470
2-[4-(dibromomethyl)phenyl]-1,3-dioxolane (PubChem CID 139917470) has the molecular formula C10H10Br2O2 and a molecular weight of 322.00 g/mol. Its IUPAC name is 2-[4-(dibromomethyl)phenyl]-1,3-dioxolane.
| Compound Name | 2-[4-(dibromomethyl)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 139917470 |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | 2-[4-(dibromomethyl)phenyl]-1,3-dioxolane |
| SMILES | BrC(Br)c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C10H10Br2O2/c11-9(12)7-1-3-8(4-2-7)10-13-5-6-14-10/h1-4,9-10H,5-6H2 |
| InChIKey | XHJRQJMFXAYTKW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|