C13H17NO5 — CID 171899906
4-[4-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanamide (PubChem CID 171899906) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-[4-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[4-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899906 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-[4-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C13H17NO5/c14-11(16)7-10(15)12(17)8-1-3-9(4-2-8)13-18-5-6-19-13/h1-4,10,12-13,15,17H,5-7H2,(H2,14,16) |
| InChIKey | ZULIYSKRRRILKE-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |