C27H27BiO6 — CID 45158487
tris[4-(1,3-dioxolan-2-yl)phenyl]bismuthane (PubChem CID 45158487) has the molecular formula C27H27BiO6 and a molecular weight of 656.49 g/mol. Its IUPAC name is tris[4-(1,3-dioxolan-2-yl)phenyl]bismuthane.
| Compound Name | tris[4-(1,3-dioxolan-2-yl)phenyl]bismuthane |
|---|---|
| PubChem CID | 45158487 |
| Molecular Formula | C27H27BiO6 |
| Molecular Weight | 656.49 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | tris[4-(1,3-dioxolan-2-yl)phenyl]bismuthane |
| SMILES | c1cc([Bi](c2ccc(C3OCCO3)cc2)c2ccc(C3OCCO3)cc2)ccc1C1OCCO1 |
| InChI | InChI=1S/3C9H9O2.Bi/c3*1-2-4-8(5-3-1)9-10-6-7-11-9;/h3*2-5,9H,6-7H2; |
| InChIKey | YSEHIYNTIZFNLZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |