C19H19ClN4O7S — CID 139918904
3-chloro-N-[3-cyano-5-(diethylsulfamoyl)-2-methoxyphenyl]-4-hydroxy-5-nitrobenzamide (PubChem CID 139918904) has the molecular formula C19H19ClN4O7S and a molecular weight of 482.90 g/mol. Its IUPAC name is 3-chloro-N-[3-cyano-5-(diethylsulfamoyl)-2-methoxyphenyl]-4-hydroxy-5-nitrobenzamide.
| Compound Name | 3-chloro-N-[3-cyano-5-(diethylsulfamoyl)-2-methoxyphenyl]-4-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 139918904 |
| Molecular Formula | C19H19ClN4O7S |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 3-chloro-N-[3-cyano-5-(diethylsulfamoyl)-2-methoxyphenyl]-4-hydroxy-5-nitrobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C#N)c(OC)c(NC(=O)c2cc(Cl)c(O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H19ClN4O7S/c1-4-23(5-2)32(29,30)13-6-12(10-21)18(31-3)15(9-13)22-19(26)11-7-14(20)17(25)16(8-11)24(27)28/h6-9,25H,4-5H2,1-3H3,(H,22,26) |
| InChIKey | RXXDSCJVAHODFE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 162.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|