C28H62N4O — CID 139919614
N'-[1-[2-[2-(dimethylamino)ethyl-methylamino]nonoxy]nonan-2-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 139919614) has the molecular formula C28H62N4O and a molecular weight of 470.83 g/mol. Its IUPAC name is N'-[1-[2-[2-(dimethylamino)ethyl-methylamino]nonoxy]nonan-2-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[1-[2-[2-(dimethylamino)ethyl-methylamino]nonoxy]nonan-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139919614 |
| Molecular Formula | C28H62N4O |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.49 |
| IUPAC Name | N'-[1-[2-[2-(dimethylamino)ethyl-methylamino]nonoxy]nonan-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CCCCCCCC(COCC(CCCCCCC)N(C)CCN(C)C)N(C)CCN(C)C |
| InChI | InChI=1S/C28H62N4O/c1-9-11-13-15-17-19-27(31(7)23-21-29(3)4)25-33-26-28(20-18-16-14-12-10-2)32(8)24-22-30(5)6/h27-28H,9-26H2,1-8H3 |
| InChIKey | JWPGBETYOHLDAM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|