C26H28F3NO4 — CID 139921738
5-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]pentanoic acid (PubChem CID 139921738) has the molecular formula C26H28F3NO4 and a molecular weight of 475.51 g/mol. Its IUPAC name is 5-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]pentanoic acid.
| Compound Name | 5-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 139921738 |
| Molecular Formula | C26H28F3NO4 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 5-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]pentanoic acid |
| SMILES | CCCCOc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CCCCC(=O)O)cc12 |
| InChI | InChI=1S/C26H28F3NO4/c1-2-3-14-33-23-16-24(26(27,28)29)30-21-13-12-18(15-20(21)23)17-34-22-10-6-4-8-19(22)9-5-7-11-25(31)32/h4,6,8,10,12-13,15-16H,2-3,5,7,9,11,14,17H2,1H3,(H,31,32) |
| InChIKey | DVJNLCPGTKEDJX-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|