C28H32F3NO4 — CID 139921770
7-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid (PubChem CID 139921770) has the molecular formula C28H32F3NO4 and a molecular weight of 503.56 g/mol. Its IUPAC name is 7-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid.
| Compound Name | 7-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 139921770 |
| Molecular Formula | C28H32F3NO4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 7-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid |
| SMILES | CCCCOc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CCCCCCC(=O)O)cc12 |
| InChI | InChI=1S/C28H32F3NO4/c1-2-3-16-35-25-18-26(28(29,30)31)32-23-15-14-20(17-22(23)25)19-36-24-12-9-8-11-21(24)10-6-4-5-7-13-27(33)34/h8-9,11-12,14-15,17-18H,2-7,10,13,16,19H2,1H3,(H,33,34) |
| InChIKey | YWYCEVDQIJETDE-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|