C27H30F3NO4 — CID 139921829
6-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]hexanoic acid (PubChem CID 139921829) has the molecular formula C27H30F3NO4 and a molecular weight of 489.53 g/mol. Its IUPAC name is 6-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]hexanoic acid.
| Compound Name | 6-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 139921829 |
| Molecular Formula | C27H30F3NO4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 6-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]hexanoic acid |
| SMILES | CCCCOc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CCCCCC(=O)O)cc12 |
| InChI | InChI=1S/C27H30F3NO4/c1-2-3-15-34-24-17-25(27(28,29)30)31-22-14-13-19(16-21(22)24)18-35-23-11-8-7-10-20(23)9-5-4-6-12-26(32)33/h7-8,10-11,13-14,16-17H,2-6,9,12,15,18H2,1H3,(H,32,33) |
| InChIKey | HUAYCFUHXNGBEB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|