C25H26F3NO4 — CID 139922020
7-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid (PubChem CID 139922020) has the molecular formula C25H26F3NO4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 7-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid.
| Compound Name | 7-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 139922020 |
| Molecular Formula | C25H26F3NO4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 7-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]heptanoic acid |
| SMILES | COc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CCCCCCC(=O)O)cc12 |
| InChI | InChI=1S/C25H26F3NO4/c1-32-22-15-23(25(26,27)28)29-20-13-12-17(14-19(20)22)16-33-21-10-7-6-9-18(21)8-4-2-3-5-11-24(30)31/h6-7,9-10,12-15H,2-5,8,11,16H2,1H3,(H,30,31) |
| InChIKey | OQKRZWNABCDFKS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|