C16H26F6N2O5 — CID 139925762
4-methyl-1,3-bis[2-[2-(trifluoromethoxy)propoxy]ethyl]imidazolidin-2-one (PubChem CID 139925762) has the molecular formula C16H26F6N2O5 and a molecular weight of 440.38 g/mol. Its IUPAC name is 4-methyl-1,3-bis[2-[2-(trifluoromethoxy)propoxy]ethyl]imidazolidin-2-one.
| Compound Name | 4-methyl-1,3-bis[2-[2-(trifluoromethoxy)propoxy]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 139925762 |
| Molecular Formula | C16H26F6N2O5 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-methyl-1,3-bis[2-[2-(trifluoromethoxy)propoxy]ethyl]imidazolidin-2-one |
| SMILES | CC(COCCN1CC(C)N(CCOCC(C)OC(F)(F)F)C1=O)OC(F)(F)F |
| InChI | InChI=1S/C16H26F6N2O5/c1-11-8-23(4-6-26-9-12(2)28-15(17,18)19)14(25)24(11)5-7-27-10-13(3)29-16(20,21)22/h11-13H,4-10H2,1-3H3 |
| InChIKey | SOBSMKCWQZDVNY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|