About 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine
2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine (PubChem CID 139927519) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine |
| PubChem CID | 139927519 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine |
| SMILES | COCC(CN(C)C)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H29NO/c1-19(2)14-18(15-20-3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4,6-7,10-11,17H,5,8-9,12-15H2,1-3H3 |
| InChIKey | JWROIRQPHGNSGL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine?
The IUPAC name of 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine (CID 139927519) is 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine.
What is the SMILES notation for 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine?
The canonical SMILES for 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine is COCC(CN(C)C)(c1ccccc1)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine?
The InChIKey is JWROIRQPHGNSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO/c1-19(2)14-18(15-20-3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4,6-7,10-11,17H,5,8-9,12-15H2,1-3H3.
What are the key properties of 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine?
2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine has a molecular weight of 275.44 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-3-methoxy-N,N-dimethyl-2-phenylpropan-1-amine is sourced from PubChem (CID 139927519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).