C16H30N2S — CID 139928363
2,4-dimethyl-6-undecyl-2H-1,3,5-thiadiazine (PubChem CID 139928363) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 2,4-dimethyl-6-undecyl-2H-1,3,5-thiadiazine.
| Compound Name | 2,4-dimethyl-6-undecyl-2H-1,3,5-thiadiazine |
|---|---|
| PubChem CID | 139928363 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2,4-dimethyl-6-undecyl-2H-1,3,5-thiadiazine |
| SMILES | CCCCCCCCCCCC1=NC(C)=NC(C)S1 |
| InChI | InChI=1S/C16H30N2S/c1-4-5-6-7-8-9-10-11-12-13-16-18-14(2)17-15(3)19-16/h15H,4-13H2,1-3H3 |
| InChIKey | ROJRUNOUXSPFOA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|