C20H18ClF3N4O4 — CID 139928631
[(5-chloro-2-pyridinyl)-[2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139928631) has the molecular formula C20H18ClF3N4O4 and a molecular weight of 470.84 g/mol. Its IUPAC name is [(5-chloro-2-pyridinyl)-[2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(5-chloro-2-pyridinyl)-[2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139928631 |
| Molecular Formula | C20H18ClF3N4O4 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [(5-chloro-2-pyridinyl)-[2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(Nc1ccccc1C(=O)N(OC(=O)C(F)(F)F)c1ccc(Cl)cn1)C1CCNCC1 |
| InChI | InChI=1S/C20H18ClF3N4O4/c21-13-5-6-16(26-11-13)28(32-19(31)20(22,23)24)18(30)14-3-1-2-4-15(14)27-17(29)12-7-9-25-10-8-12/h1-6,11-12,25H,7-10H2,(H,27,29) |
| InChIKey | ILUIOVFNVVLECD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|