C21H20ClF3N4O5 — CID 139928647
[(5-chloro-2-pyridinyl)-[5-methoxy-2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139928647) has the molecular formula C21H20ClF3N4O5 and a molecular weight of 500.86 g/mol. Its IUPAC name is [(5-chloro-2-pyridinyl)-[5-methoxy-2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(5-chloro-2-pyridinyl)-[5-methoxy-2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139928647 |
| Molecular Formula | C21H20ClF3N4O5 |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | [(5-chloro-2-pyridinyl)-[5-methoxy-2-(piperidine-4-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(NC(=O)C2CCNCC2)c(C(=O)N(OC(=O)C(F)(F)F)c2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C21H20ClF3N4O5/c1-33-14-3-4-16(28-18(30)12-6-8-26-9-7-12)15(10-14)19(31)29(34-20(32)21(23,24)25)17-5-2-13(22)11-27-17/h2-5,10-12,26H,6-9H2,1H3,(H,28,30) |
| InChIKey | FGCUXHIIJOGHPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|