C20H19ClF3N5O4 — CID 139928644
[(5-chloro-2-pyridinyl)-[5-methyl-2-(piperazine-1-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139928644) has the molecular formula C20H19ClF3N5O4 and a molecular weight of 485.85 g/mol. Its IUPAC name is [(5-chloro-2-pyridinyl)-[5-methyl-2-(piperazine-1-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(5-chloro-2-pyridinyl)-[5-methyl-2-(piperazine-1-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139928644 |
| Molecular Formula | C20H19ClF3N5O4 |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [(5-chloro-2-pyridinyl)-[5-methyl-2-(piperazine-1-carbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(NC(=O)N2CCNCC2)c(C(=O)N(OC(=O)C(F)(F)F)c2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C20H19ClF3N5O4/c1-12-2-4-15(27-19(32)28-8-6-25-7-9-28)14(10-12)17(30)29(33-18(31)20(22,23)24)16-5-3-13(21)11-26-16/h2-5,10-11,25H,6-9H2,1H3,(H,27,32) |
| InChIKey | ZYOQYVMECSJIGM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|