C19H16ClF3N4O5 — CID 139928643
[(5-chloro-2-pyridinyl)-[2-(pyrrolidin-3-yloxycarbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139928643) has the molecular formula C19H16ClF3N4O5 and a molecular weight of 472.81 g/mol. Its IUPAC name is [(5-chloro-2-pyridinyl)-[2-(pyrrolidin-3-yloxycarbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(5-chloro-2-pyridinyl)-[2-(pyrrolidin-3-yloxycarbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139928643 |
| Molecular Formula | C19H16ClF3N4O5 |
| Molecular Weight | 472.81 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [(5-chloro-2-pyridinyl)-[2-(pyrrolidin-3-yloxycarbonylamino)benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(Nc1ccccc1C(=O)N(OC(=O)C(F)(F)F)c1ccc(Cl)cn1)OC1CCNC1 |
| InChI | InChI=1S/C19H16ClF3N4O5/c20-11-5-6-15(25-9-11)27(32-17(29)19(21,22)23)16(28)13-3-1-2-4-14(13)26-18(30)31-12-7-8-24-10-12/h1-6,9,12,24H,7-8,10H2,(H,26,30) |
| InChIKey | ZOOUZRWOHFTUTM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|