C10H15N7 — CID 1399308
(2-hydrazinyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)hydrazine (PubChem CID 1399308) has the molecular formula C10H15N7 and a molecular weight of 233.28 g/mol. Its IUPAC name is (2-hydrazinyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)hydrazine.
| Compound Name | (2-hydrazinyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)hydrazine |
|---|---|
| PubChem CID | 1399308 |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2-hydrazinyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)hydrazine |
| SMILES | NNc1nc(NN)c2c3c([nH]c2n1)CCCC3 |
| InChI | InChI=1S/C10H15N7/c11-16-9-7-5-3-1-2-4-6(5)13-8(7)14-10(15-9)17-12/h1-4,11-12H2,(H3,13,14,15,16,17) |
| InChIKey | UYRZXDJAWDRCDM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|