About 3,5-diamino-2,6-dihydroxybenzamide
3,5-diamino-2,6-dihydroxybenzamide (PubChem CID 139938783) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is 3,5-diamino-2,6-dihydroxybenzamide.
Molecular Properties
| Compound Name | 3,5-diamino-2,6-dihydroxybenzamide |
| PubChem CID | 139938783 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3,5-diamino-2,6-dihydroxybenzamide |
| SMILES | NC(=O)c1c(O)c(N)cc(N)c1O |
| InChI | InChI=1S/C7H9N3O3/c8-2-1-3(9)6(12)4(5(2)11)7(10)13/h1,11-12H,8-9H2,(H2,10,13) |
| InChIKey | GPXSAELHMYYGGX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-2,6-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-2,6-dihydroxybenzamide?
The IUPAC name of 3,5-diamino-2,6-dihydroxybenzamide (CID 139938783) is 3,5-diamino-2,6-dihydroxybenzamide.
What is the SMILES notation for 3,5-diamino-2,6-dihydroxybenzamide?
The canonical SMILES for 3,5-diamino-2,6-dihydroxybenzamide is NC(=O)c1c(O)c(N)cc(N)c1O.
What is the InChIKey of 3,5-diamino-2,6-dihydroxybenzamide?
The InChIKey is GPXSAELHMYYGGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3/c8-2-1-3(9)6(12)4(5(2)11)7(10)13/h1,11-12H,8-9H2,(H2,10,13).
What are the key properties of 3,5-diamino-2,6-dihydroxybenzamide?
3,5-diamino-2,6-dihydroxybenzamide has a molecular weight of 183.17 g/mol, XLogP of -0.64, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-2,6-dihydroxybenzamide is sourced from PubChem (CID 139938783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).