C7H9N3O3 — CID 139938783
3,5-diamino-2,6-dihydroxybenzamide (PubChem CID 139938783) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 3,5-diamino-2,6-dihydroxybenzamide.
| Compound Name | 3,5-diamino-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 139938783 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3,5-diamino-2,6-dihydroxybenzamide |
| SMILES | NC(=O)c1c(O)c(N)cc(N)c1O |
| InChI | InChI=1S/C7H9N3O3/c8-2-1-3(9)6(12)4(5(2)11)7(10)13/h1,11-12H,8-9H2,(H2,10,13) |
| InChIKey | GPXSAELHMYYGGX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|