C7H10N3OP — CID 163504377
2,6-diamino-4-phosphanylbenzamide (PubChem CID 163504377) has the molecular formula C7H10N3OP and a molecular weight of 183.15 g/mol. Its IUPAC name is 2,6-diamino-4-phosphanylbenzamide.
| Compound Name | 2,6-diamino-4-phosphanylbenzamide |
|---|---|
| PubChem CID | 163504377 |
| Molecular Formula | C7H10N3OP |
| Molecular Weight | 183.15 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2,6-diamino-4-phosphanylbenzamide |
| SMILES | NC(=O)c1c(N)cc(P)cc1N |
| InChI | InChI=1S/C7H10N3OP/c8-4-1-3(12)2-5(9)6(4)7(10)11/h1-2H,8-9,12H2,(H2,10,11) |
| InChIKey | CXJFVFDUEPOMFG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|