C17H24O4 — CID 139939081
bis(2-methylprop-2-enyl) bicyclo[2.2.1]heptane-2,5-dicarboxylate (PubChem CID 139939081) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is bis(2-methylprop-2-enyl) bicyclo[2.2.1]heptane-2,5-dicarboxylate.
| Compound Name | bis(2-methylprop-2-enyl) bicyclo[2.2.1]heptane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 139939081 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | bis(2-methylprop-2-enyl) bicyclo[2.2.1]heptane-2,5-dicarboxylate |
| SMILES | C=C(C)COC(=O)C1CC2CC1CC2C(=O)OCC(=C)C |
| InChI | InChI=1S/C17H24O4/c1-10(2)8-20-16(18)14-6-13-5-12(14)7-15(13)17(19)21-9-11(3)4/h12-15H,1,3,5-9H2,2,4H3 |
| InChIKey | ZGRFSNVYHSKRCQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|