C10H14O3 — CID 12000687
2-methylprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 12000687) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-methylprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | 2-methylprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 12000687 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-methylprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C=C(C)COC(=O)C1CC2OC2C1 |
| InChI | InChI=1S/C10H14O3/c1-6(2)5-12-10(11)7-3-8-9(4-7)13-8/h7-9H,1,3-5H2,2H3 |
| InChIKey | MDBBGUGVOHDKJT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|