C19H22N4O4 — CID 139942545
2-(dimethylamino)ethyl 2-[(Z)-(3-ethoxy-5-oxo-1H-pyrazol-4-ylidene)methyl]indole-1-carboxylate (PubChem CID 139942545) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[(Z)-(3-ethoxy-5-oxo-1H-pyrazol-4-ylidene)methyl]indole-1-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 2-[(Z)-(3-ethoxy-5-oxo-1H-pyrazol-4-ylidene)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 139942545 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[(Z)-(3-ethoxy-5-oxo-1H-pyrazol-4-ylidene)methyl]indole-1-carboxylate |
| SMILES | CCOC1=NNC(=O)/C1=C\c1cc2ccccc2n1C(=O)OCCN(C)C |
| InChI | InChI=1S/C19H22N4O4/c1-4-26-18-15(17(24)20-21-18)12-14-11-13-7-5-6-8-16(13)23(14)19(25)27-10-9-22(2)3/h5-8,11-12H,4,9-10H2,1-3H3,(H,20,24)/b15-12+ |
| InChIKey | HAAKHLDWMWCMJZ-NTCAYCPXSA-N |
| XLogP | 2.05 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|