C20H21Cl2N5OS — CID 139942612
1-[(2,3-dichlorophenyl)methyl]-3-(6-methoxy-3-pyridinyl)-1-[2-(3-methylimidazol-4-yl)ethyl]thiourea (PubChem CID 139942612) has the molecular formula C20H21Cl2N5OS and a molecular weight of 450.40 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-3-(6-methoxy-3-pyridinyl)-1-[2-(3-methylimidazol-4-yl)ethyl]thiourea.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-3-(6-methoxy-3-pyridinyl)-1-[2-(3-methylimidazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 139942612 |
| Molecular Formula | C20H21Cl2N5OS |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-3-(6-methoxy-3-pyridinyl)-1-[2-(3-methylimidazol-4-yl)ethyl]thiourea |
| SMILES | COc1ccc(NC(=S)N(CCc2cncn2C)Cc2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C20H21Cl2N5OS/c1-26-13-23-11-16(26)8-9-27(12-14-4-3-5-17(21)19(14)22)20(29)25-15-6-7-18(28-2)24-10-15/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,25,29) |
| InChIKey | TXBCAFSEYBWPCF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|