C17H24N2O6 — CID 139945683
2-ethyl-3-methoxy-4-[(1-methylpiperidin-4-yl)methoxy]-6-nitrobenzoic acid (PubChem CID 139945683) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-ethyl-3-methoxy-4-[(1-methylpiperidin-4-yl)methoxy]-6-nitrobenzoic acid.
| Compound Name | 2-ethyl-3-methoxy-4-[(1-methylpiperidin-4-yl)methoxy]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 139945683 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-ethyl-3-methoxy-4-[(1-methylpiperidin-4-yl)methoxy]-6-nitrobenzoic acid |
| SMILES | CCc1c(OC)c(OCC2CCN(C)CC2)cc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C17H24N2O6/c1-4-12-15(17(20)21)13(19(22)23)9-14(16(12)24-3)25-10-11-5-7-18(2)8-6-11/h9,11H,4-8,10H2,1-3H3,(H,20,21) |
| InChIKey | CITXAQXFTJZZDP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|