3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid

C17H11F2NO4S — CID 139946871

IUPAC3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid
SMILESO=C(Nc1cc(S(=O)(=O)O)c2ccccc2c1)c1cc(F)cc(F)c1
InChIInChI=1S/C17H11F2NO4S/c18-12-5-11(6-13(19)8-12)17(21)20-14-7-10-3-1-2-4-15(10)16(9-14)25(22,23)24/h1-9H,(H,20,21)(H,22,23,24)
InChIKeyMRDNCKSYFLXMKX-UHFFFAOYSA-N
MW363.34 g/mol
LogP3.62
Rot. Bonds3

About 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid

3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid (PubChem CID 139946871) has the molecular formula C17H11F2NO4S and a molecular weight of 363.34 g/mol. Its IUPAC name is 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid.

Molecular Properties

Compound Name3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid
PubChem CID139946871
Molecular FormulaC17H11F2NO4S
Molecular Weight363.34 g/mol
Exact Mass363.04
IUPAC Name3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid
SMILESO=C(Nc1cc(S(=O)(=O)O)c2ccccc2c1)c1cc(F)cc(F)c1
InChIInChI=1S/C17H11F2NO4S/c18-12-5-11(6-13(19)8-12)17(21)20-14-7-10-3-1-2-4-15(10)16(9-14)25(22,23)24/h1-9H,(H,20,21)(H,22,23,24)
InChIKeyMRDNCKSYFLXMKX-UHFFFAOYSA-N
XLogP3.62
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.34
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid?
The IUPAC name of 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid (CID 139946871) is 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid.
What is the SMILES notation for 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid?
The canonical SMILES for 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid is O=C(Nc1cc(S(=O)(=O)O)c2ccccc2c1)c1cc(F)cc(F)c1.
What is the InChIKey of 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid?
The InChIKey is MRDNCKSYFLXMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2NO4S/c18-12-5-11(6-13(19)8-12)17(21)20-14-7-10-3-1-2-4-15(10)16(9-14)25(22,23)24/h1-9H,(H,20,21)(H,22,23,24).
What are the key properties of 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid?
3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid has a molecular weight of 363.34 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid is sourced from PubChem (CID 139946871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).