C17H11F2NO4S — CID 139946871
3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid (PubChem CID 139946871) has the molecular formula C17H11F2NO4S and a molecular weight of 363.34 g/mol. Its IUPAC name is 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 139946871 |
| Molecular Formula | C17H11F2NO4S |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 3-[(3,5-difluorobenzoyl)amino]naphthalene-1-sulfonic acid |
| SMILES | O=C(Nc1cc(S(=O)(=O)O)c2ccccc2c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H11F2NO4S/c18-12-5-11(6-13(19)8-12)17(21)20-14-7-10-3-1-2-4-15(10)16(9-14)25(22,23)24/h1-9H,(H,20,21)(H,22,23,24) |
| InChIKey | MRDNCKSYFLXMKX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|