C21H24N6O5S — CID 139949936
(2S,3S,4R,5R)-3,4-dihydroxy-5-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolane-2-carboxylic acid (PubChem CID 139949936) has the molecular formula C21H24N6O5S and a molecular weight of 472.53 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-5-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 139949936 |
| Molecular Formula | C21H24N6O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolane-2-carboxylic acid |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccccc2)c2nnn([C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C21H24N6O5S/c1-2-8-33-21-23-17(22-12-9-11(12)10-6-4-3-5-7-10)13-18(24-21)27(26-25-13)19-15(29)14(28)16(32-19)20(30)31/h3-7,11-12,14-16,19,28-29H,2,8-9H2,1H3,(H,30,31)(H,22,23,24)/t11-,12+,14-,15+,16-,19+/m0/s1 |
| InChIKey | PGZOSYHDKUKRRS-DILUYFLMSA-N |
| XLogP | 1.40 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |