C14H17F6NO2 — CID 139965827
1-[3,5-bis(trifluoromethoxy)phenyl]-N,2,2-trimethylpropan-1-amine (PubChem CID 139965827) has the molecular formula C14H17F6NO2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethoxy)phenyl]-N,2,2-trimethylpropan-1-amine.
| Compound Name | 1-[3,5-bis(trifluoromethoxy)phenyl]-N,2,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 139965827 |
| Molecular Formula | C14H17F6NO2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-[3,5-bis(trifluoromethoxy)phenyl]-N,2,2-trimethylpropan-1-amine |
| SMILES | CNC(c1cc(OC(F)(F)F)cc(OC(F)(F)F)c1)C(C)(C)C |
| InChI | InChI=1S/C14H17F6NO2/c1-12(2,3)11(21-4)8-5-9(22-13(15,16)17)7-10(6-8)23-14(18,19)20/h5-7,11,21H,1-4H3 |
| InChIKey | XYOOZDMBUWVKPH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |