C9H16N2O — CID 139967857
2-(5-methylhexa-3,5-dienylamino)acetamide (PubChem CID 139967857) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(5-methylhexa-3,5-dienylamino)acetamide.
| Compound Name | 2-(5-methylhexa-3,5-dienylamino)acetamide |
|---|---|
| PubChem CID | 139967857 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-(5-methylhexa-3,5-dienylamino)acetamide |
| SMILES | C=C(C)C=CCCNCC(N)=O |
| InChI | InChI=1S/C9H16N2O/c1-8(2)5-3-4-6-11-7-9(10)12/h3,5,11H,1,4,6-7H2,2H3,(H2,10,12) |
| InChIKey | FGKGHKCKYIECFA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|