C12H20N2O — CID 122663069
N-[2-[[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]ethyl]acetamide (PubChem CID 122663069) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-[2-[[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122663069 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[2-[[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]ethyl]acetamide |
| SMILES | C=C/C=C\C(=C/C)CNCCNC(C)=O |
| InChI | InChI=1S/C12H20N2O/c1-4-6-7-12(5-2)10-13-8-9-14-11(3)15/h4-7,13H,1,8-10H2,2-3H3,(H,14,15)/b7-6-,12-5+ |
| InChIKey | ZWMZAZFFXLEDIJ-BZNMCICSSA-N |
| XLogP | 1.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|