C16H23F3N2O — CID 143453470
2-[[(3Z,6E,8Z)-3,5-dimethyl-7-(trifluoromethyl)undeca-3,6,8,10-tetraen-4-yl]amino]acetamide (PubChem CID 143453470) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-[[(3Z,6E,8Z)-3,5-dimethyl-7-(trifluoromethyl)undeca-3,6,8,10-tetraen-4-yl]amino]acetamide.
| Compound Name | 2-[[(3Z,6E,8Z)-3,5-dimethyl-7-(trifluoromethyl)undeca-3,6,8,10-tetraen-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 143453470 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-[[(3Z,6E,8Z)-3,5-dimethyl-7-(trifluoromethyl)undeca-3,6,8,10-tetraen-4-yl]amino]acetamide |
| SMILES | C=C/C=C\C(=C/C(C)/C(NCC(N)=O)=C(\C)CC)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O/c1-5-7-8-13(16(17,18)19)9-12(4)15(11(3)6-2)21-10-14(20)22/h5,7-9,12,21H,1,6,10H2,2-4H3,(H2,20,22)/b8-7-,13-9+,15-11- |
| InChIKey | XQMVXHWMJNCJIW-NIZJDLODSA-N |
| XLogP | 3.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|