C15H17N5O2 — CID 139973643
2-methyl-N-(2-nitrophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepin-5-amine (PubChem CID 139973643) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-methyl-N-(2-nitrophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepin-5-amine.
| Compound Name | 2-methyl-N-(2-nitrophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepin-5-amine |
|---|---|
| PubChem CID | 139973643 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-methyl-N-(2-nitrophenyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepin-5-amine |
| SMILES | Cc1ncc2c(n1)NCCCC2Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N5O2/c1-10-17-9-11-12(6-4-8-16-15(11)18-10)19-13-5-2-3-7-14(13)20(21)22/h2-3,5,7,9,12,19H,4,6,8H2,1H3,(H,16,17,18) |
| InChIKey | SNZWWYUZXRAWEN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|