C9H12N6 — CID 139973901
5-azido-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepine (PubChem CID 139973901) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 5-azido-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepine.
| Compound Name | 5-azido-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepine |
|---|---|
| PubChem CID | 139973901 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 5-azido-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]azepine |
| SMILES | Cc1ncc2c(n1)NCCCC2N=[N+]=[N-] |
| InChI | InChI=1S/C9H12N6/c1-6-12-5-7-8(14-15-10)3-2-4-11-9(7)13-6/h5,8H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | LVHKQPKBHOIXNR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|