About 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol
2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol (PubChem CID 82414595) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol.
Analyze 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol?
The IUPAC name of 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol (CID 82414595) is 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol.
What is the SMILES notation for 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol?
The canonical SMILES for 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol is Cc1ncc2c(n1)CNCC2O.
What is the InChIKey of 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol?
The InChIKey is ABCAXTDVWUVZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-5-10-2-6-7(11-5)3-9-4-8(6)12/h2,8-9,12H,3-4H2,1H3.
What are the key properties of 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol?
2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol has a molecular weight of 165.20 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-5-ol is sourced from PubChem (CID 82414595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).