C32H40F4O5S2 — CID 139975271
[1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 139975271) has the molecular formula C32H40F4O5S2 and a molecular weight of 644.79 g/mol. Its IUPAC name is [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 139975271 |
| Molecular Formula | C32H40F4O5S2 |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | CCCCOc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C3CC4CC3C3C5CC(CC5O)C43)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C32H40F4O5S2/c1-2-3-12-40-27-10-11-28(22-9-5-4-8-21(22)27)42(13-6-7-14-42)41-43(38,39)32(35,36)31(33,34)25-17-19-15-23(25)30-24-16-20(29(19)30)18-26(24)37/h4-5,8-11,19-20,23-26,29-30,37H,2-3,6-7,12-18H2,1H3 |
| InChIKey | QGEWFPREHAFDQD-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|