C18H24N4O3 — CID 139976389
N-hexyl-4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]-N-methylbenzamide (PubChem CID 139976389) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-hexyl-4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]-N-methylbenzamide.
| Compound Name | N-hexyl-4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 139976389 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-hexyl-4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]-N-methylbenzamide |
| SMILES | CCCCCCN(C)C(=O)c1ccc(Nc2nc(O)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-3-4-5-6-11-22(2)17(25)13-7-9-14(10-8-13)19-18-20-15(23)12-16(24)21-18/h7-10,12H,3-6,11H2,1-2H3,(H3,19,20,21,23,24) |
| InChIKey | MHIGPVUCUMRKEN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|