C22H18O5S — CID 139980079
2-(3,4-dihydroxyphenyl)-5-hydroxy-8-methoxy-2-phenyl-3H-chromene-4-thione (PubChem CID 139980079) has the molecular formula C22H18O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-8-methoxy-2-phenyl-3H-chromene-4-thione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-8-methoxy-2-phenyl-3H-chromene-4-thione |
|---|---|
| PubChem CID | 139980079 |
| Molecular Formula | C22H18O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-8-methoxy-2-phenyl-3H-chromene-4-thione |
| SMILES | COc1ccc(O)c2c1OC(c1ccccc1)(c1ccc(O)c(O)c1)CC2=S |
| InChI | InChI=1S/C22H18O5S/c1-26-18-10-9-16(24)20-19(28)12-22(27-21(18)20,13-5-3-2-4-6-13)14-7-8-15(23)17(25)11-14/h2-11,23-25H,12H2,1H3 |
| InChIKey | AXALATOYLFQZLN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|