C16H11ClF3N3OS — CID 139983801
N'-[(5-chloro-1-benzothiophen-3-yl)methyl]-4-(trifluoromethyl)pyridine-3-carbohydrazide (PubChem CID 139983801) has the molecular formula C16H11ClF3N3OS and a molecular weight of 385.80 g/mol. Its IUPAC name is N'-[(5-chloro-1-benzothiophen-3-yl)methyl]-4-(trifluoromethyl)pyridine-3-carbohydrazide.
| Compound Name | N'-[(5-chloro-1-benzothiophen-3-yl)methyl]-4-(trifluoromethyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 139983801 |
| Molecular Formula | C16H11ClF3N3OS |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N'-[(5-chloro-1-benzothiophen-3-yl)methyl]-4-(trifluoromethyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNCc1csc2ccc(Cl)cc12)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C16H11ClF3N3OS/c17-10-1-2-14-11(5-10)9(8-25-14)6-22-23-15(24)12-7-21-4-3-13(12)16(18,19)20/h1-5,7-8,22H,6H2,(H,23,24) |
| InChIKey | QBDRVBHXCOTKKN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|