C17H20ClNO6 — CID 139986086
[1-(4-chlorophenyl)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-yl]carbamic acid (PubChem CID 139986086) has the molecular formula C17H20ClNO6 and a molecular weight of 369.80 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-yl]carbamic acid.
| Compound Name | [1-(4-chlorophenyl)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 139986086 |
| Molecular Formula | C17H20ClNO6 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [1-(4-chlorophenyl)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-yl]carbamic acid |
| SMILES | CC1(C)OC(=O)C(CCC(Cc2ccc(Cl)cc2)NC(=O)O)C(=O)O1 |
| InChI | InChI=1S/C17H20ClNO6/c1-17(2)24-14(20)13(15(21)25-17)8-7-12(19-16(22)23)9-10-3-5-11(18)6-4-10/h3-6,12-13,19H,7-9H2,1-2H3,(H,22,23) |
| InChIKey | RNKNWNCEVVEDRY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|