C25H27NO6 — CID 67987694
prop-1-en-2-yl N-[(2S)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-(4-phenylphenyl)propan-2-yl]carbamate (PubChem CID 67987694) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is prop-1-en-2-yl N-[(2S)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-(4-phenylphenyl)propan-2-yl]carbamate.
| Compound Name | prop-1-en-2-yl N-[(2S)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-(4-phenylphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 67987694 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | prop-1-en-2-yl N-[(2S)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-(4-phenylphenyl)propan-2-yl]carbamate |
| SMILES | C=C(C)OC(=O)N[C@H](Cc1ccc(-c2ccccc2)cc1)CC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C25H27NO6/c1-16(2)30-24(29)26-20(15-21-22(27)31-25(3,4)32-23(21)28)14-17-10-12-19(13-11-17)18-8-6-5-7-9-18/h5-13,20-21H,1,14-15H2,2-4H3,(H,26,29)/t20-/m1/s1 |
| InChIKey | GDXSFMCYJRTTMV-HXUWFJFHSA-N |
| XLogP | 4.37 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|