C16H17ClO5 — CID 170362255
5-[(2S)-3-(4-chlorophenyl)-2-methylpropanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 170362255) has the molecular formula C16H17ClO5 and a molecular weight of 324.76 g/mol. Its IUPAC name is 5-[(2S)-3-(4-chlorophenyl)-2-methylpropanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2S)-3-(4-chlorophenyl)-2-methylpropanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 170362255 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-[(2S)-3-(4-chlorophenyl)-2-methylpropanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C[C@@H](Cc1ccc(Cl)cc1)C(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H17ClO5/c1-9(8-10-4-6-11(17)7-5-10)13(18)12-14(19)21-16(2,3)22-15(12)20/h4-7,9,12H,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | WAFVNRIJOQYEEP-VIFPVBQESA-N |
| XLogP | 2.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|