C16H16NO6- — CID 6946886
(2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-phenylpropanoate (PubChem CID 6946886) has the molecular formula C16H16NO6- and a molecular weight of 318.31 g/mol. Its IUPAC name is (2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-phenylpropanoate.
| Compound Name | (2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6946886 |
| Molecular Formula | C16H16NO6- |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-phenylpropanoate |
| SMILES | CC1(C)OC(=O)C(/C=N/[C@@H](Cc2ccccc2)C(=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C16H17NO6/c1-16(2)22-14(20)11(15(21)23-16)9-17-12(13(18)19)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,18,19)/p-1/b17-9+/t12-/m0/s1 |
| InChIKey | PKYKZEFBLAZVKB-UWONZBIMSA-M |
| XLogP | -0.13 |
| TPSA | 105.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|